 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1S(=O)(=O)N1CCCCC1)C(=O)Nc1sc2c(n1)CCN(C2)Cc1ccccc 1 |
| InChI: | InChI=1/C25H27ClN4O3S2/c26-20-10-9-19(15-23(20)35(32,33)30-12-5-2-6-13-30)24(31)28-25-27-21-11-14-29(17-22(21)34-25)16-18-7-3-1-4-8-18/h1,3-4,7-10,15H,2,5-6,11-14,16-17H2,(H,27,28,31) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.7794 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 531.101 g/mol | logS: -6.3573 | SlogP: 5.31447 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0500694 | Sterimol/B1: 2.44705 | Sterimol/B2: 4.81574 | Sterimol/B3: 5.50724 | |||
| Sterimol/B4: 7.17912 | Sterimol/L: 22.6123 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 793.563 | Positive charged surface: 475.647 | Negative charged surface: 317.917 | Volume: 468.25 | |||
| Hydrophobic surface: 671.016 | Hydrophilic surface: 122.547 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
