Type: Neutral
Formula: C21H30O3
SMILES: |
O(CC12CC(CC(C1)CC(C2)C)C)c1ccc(cc1OCC)C=O |
InChI: |
InChI=1/C21H30O3/c1-4-23-20-9-17(13-22)5-6-19(20)24-14-21-10-15(2)7-18(12-21)8-16(3)11-21/h5-6,9,13,15-16,18H,4,7-8,10-12,14H2,1-3H3/t15-,16-,18-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.468 g/mol | logS: -6.15394 | SlogP: 5.1291 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.183513 | Sterimol/B1: 2.15132 | Sterimol/B2: 4.66066 | Sterimol/B3: 5.46376 |
Sterimol/B4: 8.83152 | Sterimol/L: 15.0463 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 616.695 | Positive charged surface: 457.066 | Negative charged surface: 159.629 | Volume: 348.625 |
Hydrophobic surface: 488.835 | Hydrophilic surface: 127.86 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |