Type: Neutral
Formula: C22H33NO3
SMILES: |
O(C(=O)C1CCC(CC1)C(C)(C)C)CC(=O)Nc1ccc(cc1)C(C)C |
InChI: |
InChI=1/C22H33NO3/c1-15(2)16-8-12-19(13-9-16)23-20(24)14-26-21(25)17-6-10-18(11-7-17)22(3,4)5/h8-9,12-13,15,17-18H,6-7,10-11,14H2,1-5H3,(H,23,24)/t17-,18- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.51 g/mol | logS: -7.4149 | SlogP: 5.1442 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0292534 | Sterimol/B1: 2.76394 | Sterimol/B2: 3.88192 | Sterimol/B3: 4.36308 |
Sterimol/B4: 4.98081 | Sterimol/L: 21.8469 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 679.462 | Positive charged surface: 475.632 | Negative charged surface: 203.83 | Volume: 380.25 |
Hydrophobic surface: 515.951 | Hydrophilic surface: 163.511 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |