 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC(O)C[NH2+]Cc1n(C)c(cc1)C)C1CCCc2c1cccc2 |
| InChI: | InChI=1/C20H28N2O2/c1-15-10-11-17(22(15)2)12-21-13-18(23)14-24-20-9-5-7-16-6-3-4-8-19(16)20/h3-4,6,8,10-11,18,20-21,23H,5,7,9,12-14H2,1-2H3/p+1/t18-,20+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=41.7321 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 329.464 g/mol | logS: -2.51339 | SlogP: 2.57309 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0341845 | Sterimol/B1: 2.45707 | Sterimol/B2: 4.91648 | Sterimol/B3: 4.98574 | |||
| Sterimol/B4: 5.03372 | Sterimol/L: 19.2441 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 650.524 | Positive charged surface: 471.442 | Negative charged surface: 179.082 | Volume: 351 | |||
| Hydrophobic surface: 584.242 | Hydrophilic surface: 66.282 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
