 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC(=Nc2c1cccc2)CN(CC(=O)Nc1cc2NC(=O)Nc2cc1)CC |
| InChI: | InChI=1/C20H20N6O3/c1-2-26(10-17-22-14-6-4-3-5-13(14)19(28)25-17)11-18(27)21-12-7-8-15-16(9-12)24-20(29)23-15/h3-9H,2,10-11H2,1H3,(H,21,27)(H,22,25,28)(H2,23,24,29) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=108.269 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 392.419 g/mol | logS: -4.63465 | SlogP: 2.378 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0863361 | Sterimol/B1: 2.1413 | Sterimol/B2: 3.40693 | Sterimol/B3: 5.22805 | |||
| Sterimol/B4: 9.27202 | Sterimol/L: 17.5672 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 646.805 | Positive charged surface: 414.102 | Negative charged surface: 232.702 | Volume: 356.5 | |||
| Hydrophobic surface: 388.953 | Hydrophilic surface: 257.852 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
