Type: Neutral
Formula: C16H26N2O4
SMILES: |
o1cccc1CNC(=O)C(NC(OC(C)(C)C)=O)C(CC)C |
InChI: |
InChI=1/C16H26N2O4/c1-6-11(2)13(18-15(20)22-16(3,4)5)14(19)17-10-12-8-7-9-21-12/h7-9,11,13H,6,10H2,1-5H3,(H,17,19)(H,18,20)/t11-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.394 g/mol | logS: -3.75957 | SlogP: 3.1016 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0914092 | Sterimol/B1: 2.40711 | Sterimol/B2: 2.69886 | Sterimol/B3: 5.35314 |
Sterimol/B4: 6.75817 | Sterimol/L: 17.2391 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 581.065 | Positive charged surface: 371.794 | Negative charged surface: 209.27 | Volume: 312.875 |
Hydrophobic surface: 421.471 | Hydrophilic surface: 159.594 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |