Type: Neutral
Formula: C18H20N2O3
SMILES: |
O(C(=O)c1n(ccc1)C)CC(=O)NC1CCCc2c1cccc2 |
InChI: |
InChI=1/C18H20N2O3/c1-20-11-5-10-16(20)18(22)23-12-17(21)19-15-9-4-7-13-6-2-3-8-14(13)15/h2-3,5-6,8,10-11,15H,4,7,9,12H2,1H3,(H,19,21)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.369 g/mol | logS: -3.09809 | SlogP: 2.83037 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0643122 | Sterimol/B1: 2.49426 | Sterimol/B2: 4.49751 | Sterimol/B3: 5.21991 |
Sterimol/B4: 5.29713 | Sterimol/L: 17.1117 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 574.583 | Positive charged surface: 375.643 | Negative charged surface: 198.94 | Volume: 305.75 |
Hydrophobic surface: 478.538 | Hydrophilic surface: 96.045 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |