 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCCc2c1cccc2)CNCC([NH+](C)C)c1ccccc1 |
| InChI: | InChI=1/C22H29N3O/c1-25(2)21(18-10-4-3-5-11-18)15-23-16-22(26)24-20-14-8-12-17-9-6-7-13-19(17)20/h3-7,9-11,13,20-21,23H,8,12,14-16H2,1-2H3,(H,24,26)/p+1/t20-,21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=73.8449 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 352.502 g/mol | logS: -3.84021 | SlogP: 1.84657 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0740204 | Sterimol/B1: 2.97533 | Sterimol/B2: 3.0771 | Sterimol/B3: 5.4998 | |||
| Sterimol/B4: 7.04953 | Sterimol/L: 18.6843 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 671.753 | Positive charged surface: 477.23 | Negative charged surface: 194.523 | Volume: 381 | |||
| Hydrophobic surface: 584.414 | Hydrophilic surface: 87.339 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
