Type: Neutral
Formula: C15H15Cl2N3O2S2
SMILES: |
Clc1cc(Cl)ccc1C(=O)NC(CCSC)C(=O)Nc1sccn1 |
InChI: |
InChI=1/C15H15Cl2N3O2S2/c1-23-6-4-12(14(22)20-15-18-5-7-24-15)19-13(21)10-3-2-9(16)8-11(10)17/h2-3,5,7-8,12H,4,6H2,1H3,(H,19,21)(H,18,20,22)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 404.342 g/mol | logS: -5.66104 | SlogP: 3.9401 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0504043 | Sterimol/B1: 2.3983 | Sterimol/B2: 2.70962 | Sterimol/B3: 4.76824 |
Sterimol/B4: 10.6434 | Sterimol/L: 17.364 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.057 | Positive charged surface: 287.107 | Negative charged surface: 337.95 | Volume: 333.625 |
Hydrophobic surface: 504.087 | Hydrophilic surface: 120.97 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |