Type: Neutral
Formula: C20H18N2O2
SMILES: |
Oc1cc(NC(=O)c2c3CCCCc3nc3c2cccc3)ccc1 |
InChI: |
InChI=1/C20H18N2O2/c23-14-7-5-6-13(12-14)21-20(24)19-15-8-1-3-10-17(15)22-18-11-4-2-9-16(18)19/h1,3,5-8,10,12,23H,2,4,9,11H2,(H,21,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.376 g/mol | logS: -4.67027 | SlogP: 4.07144 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0702701 | Sterimol/B1: 2.75609 | Sterimol/B2: 3.37259 | Sterimol/B3: 3.62342 |
Sterimol/B4: 9.53048 | Sterimol/L: 14.439 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 560.633 | Positive charged surface: 338.933 | Negative charged surface: 217.071 | Volume: 308 |
Hydrophobic surface: 461.186 | Hydrophilic surface: 99.447 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |