Type: Neutral
Formula: C21H32N2O2
SMILES: |
O=C(NCCC(=O)NC1CCCCC1C)c1ccc(cc1)C(C)(C)C |
InChI: |
InChI=1/C21H32N2O2/c1-15-7-5-6-8-18(15)23-19(24)13-14-22-20(25)16-9-11-17(12-10-16)21(2,3)4/h9-12,15,18H,5-8,13-14H2,1-4H3,(H,22,25)(H,23,24)/t15-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.499 g/mol | logS: -5.27799 | SlogP: 3.7989 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0301841 | Sterimol/B1: 2.35328 | Sterimol/B2: 2.42958 | Sterimol/B3: 4.81111 |
Sterimol/B4: 6.21008 | Sterimol/L: 21.1675 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 669.08 | Positive charged surface: 470.482 | Negative charged surface: 198.598 | Volume: 366.625 |
Hydrophobic surface: 516.358 | Hydrophilic surface: 152.722 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |