 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2c(cc1OC)CCN(Cc1ccccc1C)C2CNC(=O)C1CCCC1 |
| InChI: | InChI=1/C26H34N2O3/c1-18-8-4-5-11-21(18)17-28-13-12-20-14-24(30-2)25(31-3)15-22(20)23(28)16-27-26(29)19-9-6-7-10-19/h4-5,8,11,14-15,19,23H,6-7,9-10,12-13,16-17H2,1-3H3,(H,27,29)/t23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=129.95 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.569 g/mol | logS: -5.29465 | SlogP: 4.77989 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.247022 | Sterimol/B1: 4.5751 | Sterimol/B2: 4.60438 | Sterimol/B3: 6.31313 | |||
| Sterimol/B4: 7.53726 | Sterimol/L: 15.5015 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 692.953 | Positive charged surface: 521.079 | Negative charged surface: 171.874 | Volume: 431.875 | |||
| Hydrophobic surface: 648.617 | Hydrophilic surface: 44.336 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
