 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2c(cc1OC)CCN(Cc1ccccc1)C2C(NC(=O)C1CCCC1)C |
| InChI: | InChI=1/C26H34N2O3/c1-18(27-26(29)20-11-7-8-12-20)25-22-16-24(31-3)23(30-2)15-21(22)13-14-28(25)17-19-9-5-4-6-10-19/h4-6,9-10,15-16,18,20,25H,7-8,11-14,17H2,1-3H3,(H,27,29)/t18-,25-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=164.9 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.569 g/mol | logS: -5.14794 | SlogP: 4.85997 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.24931 | Sterimol/B1: 2.13634 | Sterimol/B2: 6.26534 | Sterimol/B3: 7.36785 | |||
| Sterimol/B4: 7.55521 | Sterimol/L: 15.3921 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.749 | Positive charged surface: 517.971 | Negative charged surface: 183.778 | Volume: 427.625 | |||
| Hydrophobic surface: 645.73 | Hydrophilic surface: 56.019 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
