 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCN(CC1)CCCNC(=O)CC(c1cc(OC)ccc1)c1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C25H31N3O3/c1-30-20-7-4-6-19(16-20)22(23-18-27-24-9-3-2-8-21(23)24)17-25(29)26-10-5-11-28-12-14-31-15-13-28/h2-4,6-9,16,18,22,27H,5,10-15,17H2,1H3,(H,26,29)/t22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.345 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 421.541 g/mol | logS: -3.84828 | SlogP: 3.537 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0722052 | Sterimol/B1: 2.43612 | Sterimol/B2: 2.62947 | Sterimol/B3: 5.7464 | |||
| Sterimol/B4: 10.9807 | Sterimol/L: 20.7408 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 758.619 | Positive charged surface: 574.688 | Negative charged surface: 181.398 | Volume: 422.75 | |||
| Hydrophobic surface: 662.098 | Hydrophilic surface: 96.521 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
