 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccccc1Cn1c2c(CCCC2)c(C)c1C(=O)NC(C)c1ccccc1 |
| InChI: | InChI=1/C25H27FN2O/c1-17-21-13-7-9-15-23(21)28(16-20-12-6-8-14-22(20)26)24(17)25(29)27-18(2)19-10-4-3-5-11-19/h3-6,8,10-12,14,18H,7,9,13,15-16H2,1-2H3,(H,27,29)/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.51 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 390.502 g/mol | logS: -5.42843 | SlogP: 5.71556 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.172561 | Sterimol/B1: 2.28471 | Sterimol/B2: 3.1681 | Sterimol/B3: 5.30776 | |||
| Sterimol/B4: 9.64421 | Sterimol/L: 15.6934 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 632.339 | Positive charged surface: 397.448 | Negative charged surface: 234.891 | Volume: 391 | |||
| Hydrophobic surface: 573.373 | Hydrophilic surface: 58.966 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.