 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CN(C(=O)C1CC1c1ccccc1)CC1N(CCC1)CC |
| InChI: | InChI=1/C25H30N2O3/c1-2-26-12-6-9-20(26)16-27(15-18-10-11-23-24(13-18)30-17-29-23)25(28)22-14-21(22)19-7-4-3-5-8-19/h3-5,7-8,10-11,13,20-22H,2,6,9,12,14-17H2,1H3/t20-,21+,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=106.626 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.526 g/mol | logS: -3.96862 | SlogP: 4.2983 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.178937 | Sterimol/B1: 2.50902 | Sterimol/B2: 3.01228 | Sterimol/B3: 6.75104 | |||
| Sterimol/B4: 8.43118 | Sterimol/L: 18.2197 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 696.345 | Positive charged surface: 463.726 | Negative charged surface: 232.62 | Volume: 411 | |||
| Hydrophobic surface: 587.456 | Hydrophilic surface: 108.889 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
