 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CC(N(C(=O)c2ccccc2)C12CCC(CC2)C)C(=O)NCc1ccncc1 |
| InChI: | InChI=1/C23H27N3O3/c1-17-7-11-23(12-8-17)26(22(28)19-5-3-2-4-6-19)20(16-29-23)21(27)25-15-18-9-13-24-14-10-18/h2-6,9-10,13-14,17,20H,7-8,11-12,15-16H2,1H3,(H,25,27)/t17-,20-,23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=278.936 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 393.487 g/mol | logS: -4.44115 | SlogP: 3.4118 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0754983 | Sterimol/B1: 3.33582 | Sterimol/B2: 4.22105 | Sterimol/B3: 5.06167 | |||
| Sterimol/B4: 6.09206 | Sterimol/L: 16.7538 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 604.987 | Positive charged surface: 427.962 | Negative charged surface: 177.024 | Volume: 376 | |||
| Hydrophobic surface: 527.492 | Hydrophilic surface: 77.495 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.