 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CC(N(C(=O)C2CCCC2)C12CC(CCC2)C)C(=O)NCc1cccnc1 |
| InChI: | InChI=1/C22H31N3O3/c1-16-6-4-10-22(12-16)25(21(27)18-8-2-3-9-18)19(15-28-22)20(26)24-14-17-7-5-11-23-13-17/h5,7,11,13,16,18-19H,2-4,6,8-10,12,14-15H2,1H3,(H,24,26)/t16-,19+,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=98.1093 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 385.508 g/mol | logS: -4.01255 | SlogP: 3.2882 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0999369 | Sterimol/B1: 2.31066 | Sterimol/B2: 2.31671 | Sterimol/B3: 6.07267 | |||
| Sterimol/B4: 8.62777 | Sterimol/L: 16.9331 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 659.901 | Positive charged surface: 498.478 | Negative charged surface: 161.422 | Volume: 383.125 | |||
| Hydrophobic surface: 569.128 | Hydrophilic surface: 90.773 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.