Type: Neutral
Formula: C15H24N4O3S
SMILES: |
s1ccnc1NC(=O)CN(CCOC)C(=O)NC1CCCCC1 |
InChI: |
InChI=1/C15H24N4O3S/c1-22-9-8-19(11-13(20)18-14-16-7-10-23-14)15(21)17-12-5-3-2-4-6-12/h7,10,12H,2-6,8-9,11H2,1H3,(H,17,21)(H,16,18,20) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 340.448 g/mol | logS: -2.57992 | SlogP: 2.0723 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0616957 | Sterimol/B1: 2.14143 | Sterimol/B2: 3.12457 | Sterimol/B3: 3.51358 |
Sterimol/B4: 9.81455 | Sterimol/L: 16.9421 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 603.626 | Positive charged surface: 461.96 | Negative charged surface: 141.666 | Volume: 323.375 |
Hydrophobic surface: 505.11 | Hydrophilic surface: 98.516 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |