Type: Neutral
Formula: C20H23ClN2O2S2
SMILES: |
Clc1ccccc1C(=O)N1C(SCC1C(=O)NCCCCC)c1sccc1 |
InChI: |
InChI=1/C20H23ClN2O2S2/c1-2-3-6-11-22-18(24)16-13-27-20(17-10-7-12-26-17)23(16)19(25)14-8-4-5-9-15(14)21/h4-5,7-10,12,16,20H,2-3,6,11,13H2,1H3,(H,22,24)/t16-,20+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 423.001 g/mol | logS: -6.48732 | SlogP: 5.0598 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.107178 | Sterimol/B1: 4.328 | Sterimol/B2: 5.01177 | Sterimol/B3: 5.68103 |
Sterimol/B4: 5.83371 | Sterimol/L: 18.7922 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 648.802 | Positive charged surface: 394.427 | Negative charged surface: 254.375 | Volume: 379.125 |
Hydrophobic surface: 549.568 | Hydrophilic surface: 99.234 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |