 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccccc1C1SCC(N1C(=O)C(C)C)C(=O)NCC[NH+]1CCCCC1 |
| InChI: | InChI=1/C21H30ClN3O2S/c1-15(2)20(27)25-18(14-28-21(25)16-8-4-5-9-17(16)22)19(26)23-10-13-24-11-6-3-7-12-24/h4-5,8-9,15,18,21H,3,6-7,10-14H2,1-2H3,(H,23,26)/p+1/t18-,21+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.5449 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.017 g/mol | logS: -4.39188 | SlogP: 2.2191 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.125174 | Sterimol/B1: 2.13781 | Sterimol/B2: 3.84703 | Sterimol/B3: 7.09311 | |||
| Sterimol/B4: 8.3199 | Sterimol/L: 16.6456 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 695.936 | Positive charged surface: 470.816 | Negative charged surface: 225.12 | Volume: 415.875 | |||
| Hydrophobic surface: 564.996 | Hydrophilic surface: 130.94 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
