Type: Neutral
Formula: C20H28N4O2S
SMILES: |
s1c(nnc1NC(=O)C(NC(=O)CC(C)C)C(CC)C)-c1cc(ccc1)C |
InChI: |
InChI=1/C20H28N4O2S/c1-6-14(5)17(21-16(25)10-12(2)3)18(26)22-20-24-23-19(27-20)15-9-7-8-13(4)11-15/h7-9,11-12,14,17H,6,10H2,1-5H3,(H,21,25)(H,22,24,26)/t14-,17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.536 g/mol | logS: -7.34287 | SlogP: 4.02902 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0421373 | Sterimol/B1: 2.5651 | Sterimol/B2: 3.70009 | Sterimol/B3: 5.43966 |
Sterimol/B4: 6.54483 | Sterimol/L: 20.5789 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 690.117 | Positive charged surface: 422.468 | Negative charged surface: 267.649 | Volume: 380.25 |
Hydrophobic surface: 515.216 | Hydrophilic surface: 174.901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |