 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1c(ccc1CN(Cc1cc(ccc1)C)C1CCCCC1)C(=O)NC(C)c1ccccc1 |
| InChI: | InChI=1/C28H34N2O2/c1-21-10-9-11-23(18-21)19-30(25-14-7-4-8-15-25)20-26-16-17-27(32-26)28(31)29-22(2)24-12-5-3-6-13-24/h3,5-6,9-13,16-18,22,25H,4,7-8,14-15,19-20H2,1-2H3,(H,29,31)/t22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=102.432 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 430.592 g/mol | logS: -7.11502 | SlogP: 7.04222 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0878662 | Sterimol/B1: 2.46294 | Sterimol/B2: 4.87733 | Sterimol/B3: 5.65563 | |||
| Sterimol/B4: 6.25585 | Sterimol/L: 18.3776 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 719.969 | Positive charged surface: 469.208 | Negative charged surface: 250.761 | Volume: 450.875 | |||
| Hydrophobic surface: 653.615 | Hydrophilic surface: 66.354 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
