Type: Neutral
Formula: C21H29N3O2S
SMILES: |
s1ccnc1NC(=O)CN(C(=O)C(CC)c1ccccc1)CCCCCC |
InChI: |
InChI=1/C21H29N3O2S/c1-3-5-6-10-14-24(16-19(25)23-21-22-13-15-27-21)20(26)18(4-2)17-11-8-7-9-12-17/h7-9,11-13,15,18H,3-6,10,14,16H2,1-2H3,(H,22,23,25)/t18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 387.548 g/mol | logS: -5.74592 | SlogP: 4.6843 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.146278 | Sterimol/B1: 4.0897 | Sterimol/B2: 4.31553 | Sterimol/B3: 5.29352 |
Sterimol/B4: 8.7206 | Sterimol/L: 18.1117 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 697.583 | Positive charged surface: 471.465 | Negative charged surface: 226.118 | Volume: 392.125 |
Hydrophobic surface: 577.842 | Hydrophilic surface: 119.741 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |