 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CCCNC(=O)c1cc(NC(=O)CCC)ccc1N1CCc2c(C1)cccc2)CC |
| InChI: | InChI=1/C25H33N3O3/c1-3-8-24(29)27-21-11-12-23(22(17-21)25(30)26-14-7-16-31-4-2)28-15-13-19-9-5-6-10-20(19)18-28/h5-6,9-12,17H,3-4,7-8,13-16,18H2,1-2H3,(H,26,30)(H,27,29) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=143.2 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.557 g/mol | logS: -5.00825 | SlogP: 4.41067 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0659274 | Sterimol/B1: 2.48366 | Sterimol/B2: 3.84081 | Sterimol/B3: 4.58736 | |||
| Sterimol/B4: 13.5743 | Sterimol/L: 17.8853 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 797.477 | Positive charged surface: 586.095 | Negative charged surface: 211.382 | Volume: 433.75 | |||
| Hydrophobic surface: 669.997 | Hydrophilic surface: 127.48 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.