Type: Neutral
Formula: C19H21N5O4
SMILES: |
O1CCCC1CN(CC(=O)Nc1noc(c1)C)C(=O)Nc1ccc(cc1)C#N |
InChI: |
InChI=1/C19H21N5O4/c1-13-9-17(23-28-13)22-18(25)12-24(11-16-3-2-8-27-16)19(26)21-15-6-4-14(10-20)5-7-15/h4-7,9,16H,2-3,8,11-12H2,1H3,(H,21,26)(H,22,23,25)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 383.408 g/mol | logS: -3.63558 | SlogP: 2.5063 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.112589 | Sterimol/B1: 2.42729 | Sterimol/B2: 5.30476 | Sterimol/B3: 6.43383 |
Sterimol/B4: 8.21242 | Sterimol/L: 17.0327 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 668.045 | Positive charged surface: 419.68 | Negative charged surface: 248.366 | Volume: 356 |
Hydrophobic surface: 481.754 | Hydrophilic surface: 186.291 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |