 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1cc(C(=O)NC(CC)C)c(N2CCCCC2)cc1)C1CC1c1ccccc1 |
| InChI: | InChI=1/C26H33N3O2/c1-3-18(2)27-26(31)23-16-20(12-13-24(23)29-14-8-5-9-15-29)28-25(30)22-17-21(22)19-10-6-4-7-11-19/h4,6-7,10-13,16,18,21-22H,3,5,8-9,14-15,17H2,1-2H3,(H,27,31)(H,28,30)/t18-,21+,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=144.138 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 419.569 g/mol | logS: -5.08187 | SlogP: 4.9474 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0563444 | Sterimol/B1: 2.0144 | Sterimol/B2: 2.48064 | Sterimol/B3: 5.81731 | |||
| Sterimol/B4: 10.8378 | Sterimol/L: 19.2647 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 760.438 | Positive charged surface: 518.838 | Negative charged surface: 241.6 | Volume: 435.375 | |||
| Hydrophobic surface: 633.833 | Hydrophilic surface: 126.605 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.