 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc(ccc1)C(CC(=O)NC1CCCCNC1=O)c1n2c(nc1)C(=CC=C2)C |
| InChI: | InChI=1/C24H28N4O3/c1-16-7-6-12-28-21(15-26-23(16)28)19(17-8-5-9-18(13-17)31-2)14-22(29)27-20-10-3-4-11-25-24(20)30/h5-9,12-13,15,19-20H,3-4,10-11,14H2,1-2H3,(H,25,30)(H,27,29)/t19-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=125.669 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 420.513 g/mol | logS: -3.49467 | SlogP: 3.0862 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.135649 | Sterimol/B1: 2.39748 | Sterimol/B2: 3.73021 | Sterimol/B3: 5.44934 | |||
| Sterimol/B4: 11.4334 | Sterimol/L: 16.2533 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.255 | Positive charged surface: 486.316 | Negative charged surface: 214.938 | Volume: 407.5 | |||
| Hydrophobic surface: 595.841 | Hydrophilic surface: 105.414 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
