 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N(Cc1ccccc1)Cc1n(ccc1)C)CN(C(=O)NC1CCCCC1)C1CC1 |
| InChI: | InChI=1/C25H34N4O2/c1-27-16-8-13-23(27)18-28(17-20-9-4-2-5-10-20)24(30)19-29(22-14-15-22)25(31)26-21-11-6-3-7-12-21/h2,4-5,8-10,13,16,21-22H,3,6-7,11-12,14-15,17-19H2,1H3,(H,26,31) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=53.7215 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.573 g/mol | logS: -3.61439 | SlogP: 4.9526 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.166235 | Sterimol/B1: 3.42273 | Sterimol/B2: 3.66126 | Sterimol/B3: 6.43422 | |||
| Sterimol/B4: 10.0915 | Sterimol/L: 17.9359 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 741.15 | Positive charged surface: 517.989 | Negative charged surface: 223.161 | Volume: 438.125 | |||
| Hydrophobic surface: 641.332 | Hydrophilic surface: 99.818 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.