 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC12C(Cc3c(C1=O)c(O)c1c(cccc1O)c3C)C(N(C)C)C(=O)C(C(=O)N)C2= O |
| InChI: | InChI=1/C22H22N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,15-16,25-26,31H,7H2,1-3H3,(H2,23,30)/t11-,15-,16+,22+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=189.136 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.425 g/mol | logS: -4.11982 | SlogP: -0.17101 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0589144 | Sterimol/B1: 2.62002 | Sterimol/B2: 3.16215 | Sterimol/B3: 4.24772 | |||
| Sterimol/B4: 7.73078 | Sterimol/L: 15.535 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 591.586 | Positive charged surface: 386.985 | Negative charged surface: 194.318 | Volume: 366.375 | |||
| Hydrophobic surface: 335.564 | Hydrophilic surface: 256.022 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
