 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC12C(CC3C(C1=O)C(=O)c1c(C3)c(N(C)C)ccc1O)C([NH+](C)C)C(O)=C (C(=O)N)C2=O |
| InChI: | InChI=1/C23H27N3O7/c1-25(2)12-5-6-13(27)15-10(12)7-9-8-11-17(26(3)4)19(29)16(22(24)32)21(31)23(11,33)20(30)14(9)18(15)28/h5-6,9,11,14,17,27,29,33H,7-8H2,1-4H3,(H2,24,32)/p+1/t9-,11-,14-,17+,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=77.0033 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 458.491 g/mol | logS: -2.64942 | SlogP: -1.85733 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.171899 | Sterimol/B1: 3.23208 | Sterimol/B2: 3.26169 | Sterimol/B3: 6.49907 | |||
| Sterimol/B4: 7.28446 | Sterimol/L: 15.0199 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 662.914 | Positive charged surface: 491.743 | Negative charged surface: 171.171 | Volume: 409.875 | |||
| Hydrophobic surface: 368.524 | Hydrophilic surface: 294.39 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
