 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)c1ccc(cc1)CC(NC(=O)C(NC(OC(C)(C)C)=O)CO)C(=O)N |
| InChI: | InChI=1/C24H31N3O6/c1-24(2,3)33-23(31)27-20(14-28)22(30)26-19(21(25)29)13-16-9-11-18(12-10-16)32-15-17-7-5-4-6-8-17/h4-12,19-20,28H,13-15H2,1-3H3,(H2,25,29)(H,26,30)(H,27,31)/t19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=111.015 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 457.527 g/mol | logS: -4.7178 | SlogP: 1.93017 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.064437 | Sterimol/B1: 2.4857 | Sterimol/B2: 3.68485 | Sterimol/B3: 4.00546 | |||
| Sterimol/B4: 12.1782 | Sterimol/L: 18.7545 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 798.568 | Positive charged surface: 514.339 | Negative charged surface: 284.229 | Volume: 439.75 | |||
| Hydrophobic surface: 542.592 | Hydrophilic surface: 255.976 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.