 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)c1ccc(cc1)CC(NC(OC(C)(C)C)=O)C(=O)NC(C(O)C)C(=O) N |
| InChI: | InChI=1/C25H33N3O6/c1-16(29)21(22(26)30)28-23(31)20(27-24(32)34-25(2,3)4)14-17-10-12-19(13-11-17)33-15-18-8-6-5-7-9-18/h5-13,16,20-21,29H,14-15H2,1-4H3,(H2,26,30)(H,27,32)(H,28,31)/t16-,20-,21+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=127.149 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 471.554 g/mol | logS: -5.04501 | SlogP: 2.31867 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0589786 | Sterimol/B1: 2.17985 | Sterimol/B2: 2.97912 | Sterimol/B3: 6.01365 | |||
| Sterimol/B4: 10.9296 | Sterimol/L: 21.2349 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 800.855 | Positive charged surface: 510.943 | Negative charged surface: 289.912 | Volume: 457.375 | |||
| Hydrophobic surface: 538.048 | Hydrophilic surface: 262.807 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.