 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(NC(=O)N2CCNC2=O)c2ccccc2)C(C(=O)[O-])=C (C1)C |
| InChI: | InChI=1/C20H21N5O6S/c1-10-9-32-17-13(16(27)25(17)14(10)18(28)29)22-15(26)12(11-5-3-2-4-6-11)23-20(31)24-8-7-21-19(24)30/h2-6,12-13,17H,7-9H2,1H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/p-1/t12-,13+,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=64.8071 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 458.475 g/mol | logS: -3.89766 | SlogP: -1.0182 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0887572 | Sterimol/B1: 4.20613 | Sterimol/B2: 4.38669 | Sterimol/B3: 4.53559 | |||
| Sterimol/B4: 6.83427 | Sterimol/L: 19.2097 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 708.818 | Positive charged surface: 377.352 | Negative charged surface: 304.495 | Volume: 396.125 | |||
| Hydrophobic surface: 393.145 | Hydrophilic surface: 315.673 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
