 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccc([N+](=O)[O-])cc1)C(=O)C(NC(=O)C(NC(OCc1ccccc1)=O)C) CCC(=O)N |
| InChI: | InChI=1/C23H26N4O8/c1-15(25-23(31)35-14-16-5-3-2-4-6-16)21(29)26-19(11-12-20(24)28)22(30)34-13-17-7-9-18(10-8-17)27(32)33/h2-10,15,19H,11-14H2,1H3,(H2,24,28)(H,25,31)(H,26,29)/t15-,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=84.6517 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 486.481 g/mol | logS: -5.43616 | SlogP: 2.236 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0437212 | Sterimol/B1: 1.969 | Sterimol/B2: 2.77782 | Sterimol/B3: 5.53008 | |||
| Sterimol/B4: 9.38768 | Sterimol/L: 24.6196 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 827.638 | Positive charged surface: 473.631 | Negative charged surface: 354.007 | Volume: 438.625 | |||
| Hydrophobic surface: 496.237 | Hydrophilic surface: 331.401 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.