 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)C(NC(=O)CNC(=O)CN)Cc1ccccc1)Cc1ccccc1 |
| InChI: | InChI=1/C22H26N4O5/c23-13-19(27)24-14-20(28)25-17(11-15-7-3-1-4-8-15)21(29)26-18(22(30)31)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,27)(H,25,28)(H,26,29)(H,30,31)/t17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=122.083 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.473 g/mol | logS: -3.45419 | SlogP: -0.39916 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.161681 | Sterimol/B1: 2.097 | Sterimol/B2: 3.14826 | Sterimol/B3: 7.29679 | |||
| Sterimol/B4: 8.26996 | Sterimol/L: 17.402 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 713.276 | Positive charged surface: 452.671 | Negative charged surface: 260.605 | Volume: 400.375 | |||
| Hydrophobic surface: 464.973 | Hydrophilic surface: 248.303 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.