 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)c1ccc(cc1)CC(NC(=O)C(NC(OCc1ccccc1)=O)CO)C(=O)NC C(=O)N |
| InChI: | InChI=1/C29H32N4O7/c30-26(35)16-31-27(36)24(15-20-11-13-23(14-12-20)39-18-21-7-3-1-4-8-21)32-28(37)25(17-34)33-29(38)40-19-22-9-5-2-6-10-22/h1-14,24-25,34H,15-19H2,(H2,30,35)(H,31,36)(H,32,37)(H,33,38)/t24-,25-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=122.064 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 548.596 g/mol | logS: -5.67664 | SlogP: 1.71447 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0899921 | Sterimol/B1: 2.41196 | Sterimol/B2: 3.87471 | Sterimol/B3: 5.23988 | |||
| Sterimol/B4: 17.63 | Sterimol/L: 20.8675 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 942.635 | Positive charged surface: 583.383 | Negative charged surface: 359.253 | Volume: 517.25 | |||
| Hydrophobic surface: 665.552 | Hydrophilic surface: 277.083 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.