Type: Neutral
Formula: C14H17N3O4
| SMILES: |
Oc1cc2c([nH]cc2CC(N)C(=O)NC(C(O)=O)C)cc1 |
| InChI: |
InChI=1/C14H17N3O4/c1-7(14(20)21)17-13(19)11(15)4-8-6-16-12-3-2-9(18)5-10(8)12/h2-3,5-7,11,16,18H,4,15H2,1H3,(H,17,19)(H,20,21)/t7-,11+/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 291.307 g/mol | logS: -1.53484 | SlogP: 0.33257 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0465991 | Sterimol/B1: 2.12809 | Sterimol/B2: 3.59897 | Sterimol/B3: 4.72079 |
| Sterimol/B4: 5.50894 | Sterimol/L: 16.4644 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 519.412 | Positive charged surface: 319.029 | Negative charged surface: 197.841 | Volume: 267.5 |
| Hydrophobic surface: 234.989 | Hydrophilic surface: 284.423 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |