 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(C)(C)C)c1ccc(cc1)CC(NC(OCc1ccccc1)=O)C(=O)NC(C(O)C)C(OC) =O |
| InChI: | InChI=1/C26H34N2O7/c1-17(29)22(24(31)33-5)28-23(30)21(27-25(32)34-16-19-9-7-6-8-10-19)15-18-11-13-20(14-12-18)35-26(2,3)4/h6-14,17,21-22,29H,15-16H2,1-5H3,(H,27,32)(H,28,30)/t17-,21-,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=166.029 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 486.565 g/mol | logS: -5.17462 | SlogP: 3.00637 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0528138 | Sterimol/B1: 2.66425 | Sterimol/B2: 4.39508 | Sterimol/B3: 7.00374 | |||
| Sterimol/B4: 8.40237 | Sterimol/L: 19.371 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 836.597 | Positive charged surface: 545.555 | Negative charged surface: 291.042 | Volume: 467.5 | |||
| Hydrophobic surface: 628.053 | Hydrophilic surface: 208.544 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.