Type: Neutral
Formula: C17H33N3O4
SMILES: |
O(C(C)(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(CC)C)C(=O)N |
InChI: |
InChI=1/C17H33N3O4/c1-8-11(4)13(14(18)21)20-15(22)12(9-10(2)3)19-16(23)24-17(5,6)7/h10-13H,8-9H2,1-7H3,(H2,18,21)(H,19,23)(H,20,22)/t11-,12-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.468 g/mol | logS: -4.07808 | SlogP: 1.942 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117924 | Sterimol/B1: 2.8743 | Sterimol/B2: 4.48226 | Sterimol/B3: 5.41443 |
Sterimol/B4: 6.00327 | Sterimol/L: 16.8985 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 632.733 | Positive charged surface: 442.188 | Negative charged surface: 190.545 | Volume: 353.875 |
Hydrophobic surface: 365.129 | Hydrophilic surface: 267.604 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |