Type: Neutral
Formula: C20H23N5
SMILES: |
n1cnc2n3CCCCCc3nc2c1NC1CCCc2c1cccc2 |
InChI: |
InChI=1/C20H23N5/c1-2-11-17-24-18-19(21-13-22-20(18)25(17)12-5-1)23-16-10-6-8-14-7-3-4-9-15(14)16/h3-4,7,9,13,16H,1-2,5-6,8,10-12H2,(H,21,22,23)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 333.439 g/mol | logS: -4.76343 | SlogP: 4.40404 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0967565 | Sterimol/B1: 2.45131 | Sterimol/B2: 2.8523 | Sterimol/B3: 6.0844 |
Sterimol/B4: 6.92349 | Sterimol/L: 16.3563 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.052 | Positive charged surface: 436.07 | Negative charged surface: 145.982 | Volume: 326.125 |
Hydrophobic surface: 502.794 | Hydrophilic surface: 79.258 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |