Type: Neutral
Formula: C20H21N3O3S2
SMILES: |
S1C2C(N=C1Nc1ccc(cc1)C(=O)NC(C)c1ccccc1)CS(=O)(=O)C2 |
InChI: |
InChI=1/C20H21N3O3S2/c1-13(14-5-3-2-4-6-14)21-19(24)15-7-9-16(10-8-15)22-20-23-17-11-28(25,26)12-18(17)27-20/h2-10,13,17-18H,11-12H2,1H3,(H,21,24)(H,22,23)/t13-,17-,18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 415.538 g/mol | logS: -5.37967 | SlogP: 2.9534 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0364336 | Sterimol/B1: 2.45869 | Sterimol/B2: 4.04167 | Sterimol/B3: 4.44394 |
Sterimol/B4: 7.405 | Sterimol/L: 18.2144 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 667.143 | Positive charged surface: 356.001 | Negative charged surface: 311.142 | Volume: 368.5 |
Hydrophobic surface: 469.245 | Hydrophilic surface: 197.898 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |