 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(c2c(cccc2)C12[NH+]1C(CC2C(=O)NCc2ccccc2C)CCC1)C |
| InChI: | InChI=1/C24H27N3O2/c1-16-8-3-4-9-17(16)15-25-22(28)20-14-18-10-7-13-27(18)24(20)19-11-5-6-12-21(19)26(2)23(24)29/h3-6,8-9,11-12,18,20H,7,10,13-15H2,1-2H3,(H,25,28)/p+1/t18-,20+,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.4601 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 390.507 g/mol | logS: -4.55074 | SlogP: 2.12822 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.221642 | Sterimol/B1: 1.98762 | Sterimol/B2: 4.1687 | Sterimol/B3: 6.85071 | |||
| Sterimol/B4: 7.09361 | Sterimol/L: 14.5742 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 608.511 | Positive charged surface: 426.932 | Negative charged surface: 181.579 | Volume: 392.125 | |||
| Hydrophobic surface: 547.945 | Hydrophilic surface: 60.566 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
