 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(c2c(cccc2)C12[NH+]1C(CC2C(=O)Nc2cc(ccc2)CC)CCC1)C |
| InChI: | InChI=1/C24H27N3O2/c1-3-16-8-6-9-17(14-16)25-22(28)20-15-18-10-7-13-27(18)24(20)19-11-4-5-12-21(19)26(2)23(24)29/h4-6,8-9,11-12,14,18,20H,3,7,10,13,15H2,1-2H3,(H,25,28)/p+1/t18-,20-,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=77.0399 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 390.507 g/mol | logS: -5.12192 | SlogP: 2.43807 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.177059 | Sterimol/B1: 2.97046 | Sterimol/B2: 5.44819 | Sterimol/B3: 5.77744 | |||
| Sterimol/B4: 6.34289 | Sterimol/L: 15.3816 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 650.777 | Positive charged surface: 466.595 | Negative charged surface: 184.182 | Volume: 394.375 | |||
| Hydrophobic surface: 571.851 | Hydrophilic surface: 78.926 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
