 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(c2c(cccc2)C12N1C(CC2C(=O)NCCCc2ccccc2)CCC1)C |
| InChI: | InChI=1/C25H29N3O2/c1-27-22-14-6-5-13-20(22)25(24(27)30)21(17-19-12-8-16-28(19)25)23(29)26-15-7-11-18-9-3-2-4-10-18/h2-6,9-10,13-14,19,21H,7-8,11-12,15-17H2,1H3,(H,26,29)/t19-,21+,25+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=126.462 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 403.526 g/mol | logS: -4.36445 | SlogP: 3.40307 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0984304 | Sterimol/B1: 2.47327 | Sterimol/B2: 4.51431 | Sterimol/B3: 6.60068 | |||
| Sterimol/B4: 6.68481 | Sterimol/L: 18.2293 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.936 | Positive charged surface: 455.069 | Negative charged surface: 214.868 | Volume: 403.875 | |||
| Hydrophobic surface: 616.34 | Hydrophilic surface: 53.596 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
