 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccccc1CNC(=O)C1CC2[NH+](CCC2)C12c1c(NC2=O)cccc1 |
| InChI: | InChI=1/C22H22FN3O2/c23-18-9-3-1-6-14(18)13-24-20(27)17-12-15-7-5-11-26(15)22(17)16-8-2-4-10-19(16)25-21(22)28/h1-4,6,8-10,15,17H,5,7,11-13H2,(H,24,27)(H,25,28)/p+1/t15-,17-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=56.8022 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 380.443 g/mol | logS: -4.47779 | SlogP: 1.9346 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.234542 | Sterimol/B1: 2.4123 | Sterimol/B2: 2.82853 | Sterimol/B3: 5.94247 | |||
| Sterimol/B4: 7.46407 | Sterimol/L: 13.822 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 557.846 | Positive charged surface: 383.093 | Negative charged surface: 174.753 | Volume: 361.75 | |||
| Hydrophobic surface: 470.057 | Hydrophilic surface: 87.789 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
