 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12[NH+]1C(CC2C(=O)NC(CCc2ccccc2)C)CCC1 |
| InChI: | InChI=1/C25H29N3O2/c1-17(13-14-18-8-3-2-4-9-18)26-23(29)21-16-19-10-7-15-28(19)25(21)20-11-5-6-12-22(20)27-24(25)30/h2-6,8-9,11-12,17,19,21H,7,10,13-16H2,1H3,(H,26,29)(H,27,30)/p+1/t17-,19+,21+,25+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.5161 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.534 g/mol | logS: -4.77326 | SlogP: 2.35017 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.110469 | Sterimol/B1: 2.10259 | Sterimol/B2: 3.44679 | Sterimol/B3: 4.86299 | |||
| Sterimol/B4: 9.2847 | Sterimol/L: 16.8374 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 640.673 | Positive charged surface: 449.734 | Negative charged surface: 190.939 | Volume: 411.375 | |||
| Hydrophobic surface: 537.63 | Hydrophilic surface: 103.043 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
