 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12N1C(CC2C(=O)NC(C)c2ccccc2)CCC1 |
| InChI: | InChI=1/C23H25N3O2/c1-15(16-8-3-2-4-9-16)24-21(27)19-14-17-10-7-13-26(17)23(19)18-11-5-6-12-20(18)25-22(23)28/h2-6,8-9,11-12,15,17,19H,7,10,13-14H2,1H3,(H,24,27)(H,25,28)/t15-,17+,19+,23+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=111.636 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 375.472 g/mol | logS: -4.53441 | SlogP: 3.6027 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.159126 | Sterimol/B1: 2.12001 | Sterimol/B2: 2.65259 | Sterimol/B3: 5.0537 | |||
| Sterimol/B4: 9.537 | Sterimol/L: 15.3545 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 608.243 | Positive charged surface: 403.049 | Negative charged surface: 205.194 | Volume: 367 | |||
| Hydrophobic surface: 526.922 | Hydrophilic surface: 81.321 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
