 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12[NH+]1C(CC2C(=O)Nc2cc(ccc2C)C)CCC1 |
| InChI: | InChI=1/C23H25N3O2/c1-14-9-10-15(2)20(12-14)24-21(27)18-13-16-6-5-11-26(16)23(18)17-7-3-4-8-19(17)25-22(23)28/h3-4,7-10,12,16,18H,5-6,11,13H2,1-2H3,(H,24,27)(H,25,28)/p+1/t16-,18-,23+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=77.9896 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 376.48 g/mol | logS: -4.87316 | SlogP: 2.46824 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.227977 | Sterimol/B1: 2.32766 | Sterimol/B2: 3.63086 | Sterimol/B3: 5.28944 | |||
| Sterimol/B4: 9.25462 | Sterimol/L: 13.6415 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.229 | Positive charged surface: 408.312 | Negative charged surface: 194.917 | Volume: 374.125 | |||
| Hydrophobic surface: 513.873 | Hydrophilic surface: 89.356 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
