 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12[NH+]1C(CC2C(=O)Nc2ccccc2C)CCC1 |
| InChI: | InChI=1/C22H23N3O2/c1-14-7-2-4-10-18(14)23-20(26)17-13-15-8-6-12-25(15)22(17)16-9-3-5-11-19(16)24-21(22)27/h2-5,7,9-11,15,17H,6,8,12-13H2,1H3,(H,23,26)(H,24,27)/p+1/t15-,17-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.8135 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.453 g/mol | logS: -4.39924 | SlogP: 2.15982 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.240408 | Sterimol/B1: 2.72276 | Sterimol/B2: 5.50099 | Sterimol/B3: 5.90216 | |||
| Sterimol/B4: 6.08638 | Sterimol/L: 13.7493 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 576.533 | Positive charged surface: 384.217 | Negative charged surface: 192.316 | Volume: 355.125 | |||
| Hydrophobic surface: 486.598 | Hydrophilic surface: 89.935 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
